C22H18N4O3 — CID 22668169
N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]furo[2,3-c]pyridine-2-carboxamide (PubChem CID 22668169) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22668169 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]furo[2,3-c]pyridine-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)c2cc3ccncc3o2)cc1 |
| InChI | InChI=1S/C22H18N4O3/c23-17-3-1-2-4-18(17)26-21(27)15-7-5-14(6-8-15)12-25-22(28)19-11-16-9-10-24-13-20(16)29-19/h1-11,13H,12,23H2,(H,25,28)(H,26,27) |
| InChIKey | BWDMSYLWKMZMKW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|