C23H22N4O3 — CID 141261205
N-(2-aminophenyl)-4-[[(2-benzamidoacetyl)amino]methyl]benzamide (PubChem CID 141261205) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(2-benzamidoacetyl)amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(2-benzamidoacetyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 141261205 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(2-benzamidoacetyl)amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c24-19-8-4-5-9-20(19)27-23(30)18-12-10-16(11-13-18)14-25-21(28)15-26-22(29)17-6-2-1-3-7-17/h1-13H,14-15,24H2,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | LOCYDGHLEDOXRC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|