C26H31N5O2 — CID 58001196
N-(2-aminophenyl)-4-[[benzylcarbamoyl-[2-(dimethylamino)ethyl]amino]methyl]benzamide (PubChem CID 58001196) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[benzylcarbamoyl-[2-(dimethylamino)ethyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[benzylcarbamoyl-[2-(dimethylamino)ethyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58001196 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-(2-aminophenyl)-4-[[benzylcarbamoyl-[2-(dimethylamino)ethyl]amino]methyl]benzamide |
| SMILES | CN(C)CCN(Cc1ccc(C(=O)Nc2ccccc2N)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H31N5O2/c1-30(2)16-17-31(26(33)28-18-20-8-4-3-5-9-20)19-21-12-14-22(15-13-21)25(32)29-24-11-7-6-10-23(24)27/h3-15H,16-19,27H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | QLKWZRZWCCBQEQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|