C21H28N4O2 — CID 25051606
1-N-(2-aminophenyl)-4-N-[2-(diethylamino)ethyl]-4-N-methylbenzene-1,4-dicarboxamide (PubChem CID 25051606) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-N-(2-aminophenyl)-4-N-[2-(diethylamino)ethyl]-4-N-methylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-(2-aminophenyl)-4-N-[2-(diethylamino)ethyl]-4-N-methylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 25051606 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-N-(2-aminophenyl)-4-N-[2-(diethylamino)ethyl]-4-N-methylbenzene-1,4-dicarboxamide |
| SMILES | CCN(CC)CCN(C)C(=O)c1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-4-25(5-2)15-14-24(3)21(27)17-12-10-16(11-13-17)20(26)23-19-9-7-6-8-18(19)22/h6-13H,4-5,14-15,22H2,1-3H3,(H,23,26) |
| InChIKey | PKZZIHPNPUYJBZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|