C21H22N4O3 — CID 174424077
methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate;pyridine (PubChem CID 174424077) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate;pyridine.
| Compound Name | methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate;pyridine |
|---|---|
| PubChem CID | 174424077 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate;pyridine |
| SMILES | COC(=O)NCc1ccc(C(=O)Nc2ccccc2N)cc1.c1ccncc1 |
| InChI | InChI=1S/C16H17N3O3.C5H5N/c1-22-16(21)18-10-11-6-8-12(9-7-11)15(20)19-14-5-3-2-4-13(14)17;1-2-4-6-5-3-1/h2-9H,10,17H2,1H3,(H,18,21)(H,19,20);1-5H |
| InChIKey | PFAOQMYEHQYDCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|