C21H27N5O3 — CID 22668103
(4-methylpiperazin-1-yl)methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 22668103) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | (4-methylpiperazin-1-yl)methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22668103 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (4-methylpiperazin-1-yl)methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | CN1CCN(COC(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-25-10-12-26(13-11-25)15-29-21(28)23-14-16-6-8-17(9-7-16)20(27)24-19-5-3-2-4-18(19)22/h2-9H,10-15,22H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | BBJJPSNTVXUJAI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|