C35H45N5O5 — CID 57267728
2-(3-aminopropoxy)-N-[[4-[[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]methyl]benzamide (PubChem CID 57267728) has the molecular formula C35H45N5O5 and a molecular weight of 615.78 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-N-[[4-[[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]methyl]benzamide.
| Compound Name | 2-(3-aminopropoxy)-N-[[4-[[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 57267728 |
| Molecular Formula | C35H45N5O5 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | 2-(3-aminopropoxy)-N-[[4-[[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]methyl]benzamide |
| SMILES | CN1CCN(C(=O)CCCCCOc2ccccc2NC(=O)c2ccc(CNC(=O)c3ccccc3OCCCN)cc2)CC1 |
| InChI | InChI=1S/C35H45N5O5/c1-39-20-22-40(23-21-39)33(41)14-3-2-8-24-45-32-13-7-5-11-30(32)38-34(42)28-17-15-27(16-18-28)26-37-35(43)29-10-4-6-12-31(29)44-25-9-19-36/h4-7,10-13,15-18H,2-3,8-9,14,19-26,36H2,1H3,(H,37,43)(H,38,42) |
| InChIKey | IEDQGHWAVHHTRN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|