C36H47N5O6 — CID 18791291
4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide (PubChem CID 18791291) has the molecular formula C36H47N5O6 and a molecular weight of 645.80 g/mol. Its IUPAC name is 4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide.
| Compound Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 18791291 |
| Molecular Formula | C36H47N5O6 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.35 |
| IUPAC Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
| SMILES | COc1cc(C(=O)N(C)c2ccc(OCCCCCC(=O)N3CCN(C)CC3)cc2)ccc1NC(=O)c1ccccc1OCCCN |
| InChI | InChI=1S/C36H47N5O6/c1-39-20-22-41(23-21-39)34(42)12-5-4-8-24-46-29-16-14-28(15-17-29)40(2)36(44)27-13-18-31(33(26-27)45-3)38-35(43)30-10-6-7-11-32(30)47-25-9-19-37/h6-7,10-11,13-18,26H,4-5,8-9,12,19-25,37H2,1-3H3,(H,38,43) |
| InChIKey | JKGMTVAGRZKIPT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|