C39H54N5O6+ — CID 18791694
[4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxybenzoyl]-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-dimethylazanium (PubChem CID 18791694) has the molecular formula C39H54N5O6+ and a molecular weight of 688.89 g/mol. Its IUPAC name is [4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxybenzoyl]-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-dimethylazanium.
| Compound Name | [4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxybenzoyl]-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-dimethylazanium |
|---|---|
| PubChem CID | 18791694 |
| Molecular Formula | C39H54N5O6+ |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | [4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxybenzoyl]-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-dimethylazanium |
| SMILES | COc1cc(C(=O)[N+](C)(C)c2ccccc2OCCCCCC(=O)N2CCC(N(C)C)CC2)ccc1NC(=O)c1ccccc1OCCCN |
| InChI | InChI=1S/C39H53N5O6/c1-42(2)30-21-24-43(25-22-30)37(45)18-7-6-12-26-50-35-17-11-9-15-33(35)44(3,4)39(47)29-19-20-32(36(28-29)48-5)41-38(46)31-14-8-10-16-34(31)49-27-13-23-40/h8-11,14-17,19-20,28,30H,6-7,12-13,18,21-27,40H2,1-5H3/p+1 |
| InChIKey | WFSGEIVZBOXZRW-UHFFFAOYSA-O |
| XLogP | 5.57 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|