C40H55N7O6 — CID 18791305
4-[[2-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide (PubChem CID 18791305) has the molecular formula C40H55N7O6 and a molecular weight of 729.92 g/mol. Its IUPAC name is 4-[[2-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[[2-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 18791305 |
| Molecular Formula | C40H55N7O6 |
| Molecular Weight | 729.92 g/mol |
| Exact Mass | 729.42 |
| IUPAC Name | 4-[[2-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCCCCCC(=O)N2CCC(N(C)C)CC2)ccc1NC(=O)c1ccccc1OCCCN=C(N)N |
| InChI | InChI=1S/C40H55N7O6/c1-28-15-18-33(36(26-28)53-24-10-6-7-14-37(48)47-22-19-30(20-23-47)45(2)3)46(4)39(50)29-16-17-32(35(27-29)51-5)44-38(49)31-12-8-9-13-34(31)52-25-11-21-43-40(41)42/h8-9,12-13,15-18,26-27,30H,6-7,10-11,14,19-25H2,1-5H3,(H,44,49)(H4,41,42,43) |
| InChIKey | XJPRMVXDOZXOHM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|