C35H43ClN4O5 — CID 18791472
3-chloro-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-4-[(2-hydroxybenzoyl)amino]-N-methylbenzamide (PubChem CID 18791472) has the molecular formula C35H43ClN4O5 and a molecular weight of 635.21 g/mol. Its IUPAC name is 3-chloro-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-4-[(2-hydroxybenzoyl)amino]-N-methylbenzamide.
| Compound Name | 3-chloro-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-4-[(2-hydroxybenzoyl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 18791472 |
| Molecular Formula | C35H43ClN4O5 |
| Molecular Weight | 635.21 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 3-chloro-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-4-[(2-hydroxybenzoyl)amino]-N-methylbenzamide |
| SMILES | Cc1ccc(N(C)C(=O)c2ccc(NC(=O)c3ccccc3O)c(Cl)c2)c(OCCCCCC(=O)N2CCC(N(C)C)CC2)c1 |
| InChI | InChI=1S/C35H43ClN4O5/c1-24-13-16-30(32(22-24)45-21-9-5-6-12-33(42)40-19-17-26(18-20-40)38(2)3)39(4)35(44)25-14-15-29(28(36)23-25)37-34(43)27-10-7-8-11-31(27)41/h7-8,10-11,13-16,22-23,26,41H,5-6,9,12,17-21H2,1-4H3,(H,37,43) |
| InChIKey | MYDXTUMNFYIJSQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.21 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|