C37H51N5O10S — CID 18791632
4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;sulfuric acid (PubChem CID 18791632) has the molecular formula C37H51N5O10S and a molecular weight of 757.91 g/mol. Its IUPAC name is 4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;sulfuric acid.
| Compound Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;sulfuric acid |
|---|---|
| PubChem CID | 18791632 |
| Molecular Formula | C37H51N5O10S |
| Molecular Weight | 757.91 g/mol |
| Exact Mass | 757.34 |
| IUPAC Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;sulfuric acid |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCCCCCC(=O)N2CCN(C)CC2)ccc1NC(=O)c1ccccc1OCCCN.O=S(=O)(O)O |
| InChI | InChI=1S/C37H49N5O6.H2O4S/c1-27-14-17-31(34(25-27)48-23-9-5-6-13-35(43)42-21-19-40(2)20-22-42)41(3)37(45)28-15-16-30(33(26-28)46-4)39-36(44)29-11-7-8-12-32(29)47-24-10-18-38;1-5(2,3)4/h7-8,11-12,14-17,25-26H,5-6,9-10,13,18-24,38H2,1-4H3,(H,39,44);(H2,1,2,3,4) |
| InChIKey | IXOTYFXZGMUETC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 201.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|