C34H45Cl2N5O5 — CID 18791660
4-[(2-aminobenzoyl)amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;dihydrochloride (PubChem CID 18791660) has the molecular formula C34H45Cl2N5O5 and a molecular weight of 674.67 g/mol. Its IUPAC name is 4-[(2-aminobenzoyl)amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;dihydrochloride.
| Compound Name | 4-[(2-aminobenzoyl)amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 18791660 |
| Molecular Formula | C34H45Cl2N5O5 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 673.28 |
| IUPAC Name | 4-[(2-aminobenzoyl)amino]-3-methoxy-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide;dihydrochloride |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCCCCCC(=O)N2CCN(C)CC2)ccc1NC(=O)c1ccccc1N.Cl.Cl |
| InChI | InChI=1S/C34H43N5O5.2ClH/c1-24-13-16-29(31(22-24)44-21-9-5-6-12-32(40)39-19-17-37(2)18-20-39)38(3)34(42)25-14-15-28(30(23-25)43-4)36-33(41)26-10-7-8-11-27(26)35;;/h7-8,10-11,13-16,22-23H,5-6,9,12,17-21,35H2,1-4H3,(H,36,41);2*1H |
| InChIKey | BUFFPZVDONYHBC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|