C43H53N5O6 — CID 18791544
4-[[2-(3-aminopropoxy)benzoyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]-3-phenylmethoxybenzamide (PubChem CID 18791544) has the molecular formula C43H53N5O6 and a molecular weight of 735.93 g/mol. Its IUPAC name is 4-[[2-(3-aminopropoxy)benzoyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]-3-phenylmethoxybenzamide.
| Compound Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 18791544 |
| Molecular Formula | C43H53N5O6 |
| Molecular Weight | 735.93 g/mol |
| Exact Mass | 735.40 |
| IUPAC Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]-3-phenylmethoxybenzamide |
| SMILES | Cc1ccc(N(C)C(=O)c2ccc(NC(=O)c3ccccc3OCCCN)c(OCc3ccccc3)c2)c(OCCCCCC(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C43H53N5O6/c1-32-18-21-37(40(29-32)53-27-11-5-8-17-41(49)48-25-23-46(2)24-26-48)47(3)43(51)34-19-20-36(39(30-34)54-31-33-13-6-4-7-14-33)45-42(50)35-15-9-10-16-38(35)52-28-12-22-44/h4,6-7,9-10,13-16,18-21,29-30H,5,8,11-12,17,22-28,31,44H2,1-3H3,(H,45,50) |
| InChIKey | CKMOVDZLRYCKRP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.93 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|