C31H37N3O6 — CID 18791608
6-[2-[[4-[[2-(3-aminopropoxy)benzoyl]amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoic acid (PubChem CID 18791608) has the molecular formula C31H37N3O6 and a molecular weight of 547.65 g/mol. Its IUPAC name is 6-[2-[[4-[[2-(3-aminopropoxy)benzoyl]amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoic acid.
| Compound Name | 6-[2-[[4-[[2-(3-aminopropoxy)benzoyl]amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 18791608 |
| Molecular Formula | C31H37N3O6 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 6-[2-[[4-[[2-(3-aminopropoxy)benzoyl]amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoic acid |
| SMILES | Cc1ccc(N(C)C(=O)c2ccc(NC(=O)c3ccccc3OCCCN)cc2)c(OCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C31H37N3O6/c1-22-12-17-26(28(21-22)40-19-7-3-4-11-29(35)36)34(2)31(38)23-13-15-24(16-14-23)33-30(37)25-9-5-6-10-27(25)39-20-8-18-32/h5-6,9-10,12-17,21H,3-4,7-8,11,18-20,32H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | QECBEHSVJMORON-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|