C31H36N2O6 — CID 18791264
ethyl 6-[2-[[4-[(2-methoxybenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate (PubChem CID 18791264) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is ethyl 6-[2-[[4-[(2-methoxybenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[[4-[(2-methoxybenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate |
|---|---|
| PubChem CID | 18791264 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | ethyl 6-[2-[[4-[(2-methoxybenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc(C)ccc1N(C)C(=O)c1ccc(NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C31H36N2O6/c1-5-38-29(34)13-7-6-10-20-39-28-21-22(2)14-19-26(28)33(3)31(36)23-15-17-24(18-16-23)32-30(35)25-11-8-9-12-27(25)37-4/h8-9,11-12,14-19,21H,5-7,10,13,20H2,1-4H3,(H,32,35) |
| InChIKey | YXARBGDHFLNWFU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|