C33H32N2O5 — CID 22010932
6-[2-[methyl-[4-[(2-phenylbenzoyl)amino]benzoyl]amino]phenoxy]hexanoic acid (PubChem CID 22010932) has the molecular formula C33H32N2O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is 6-[2-[methyl-[4-[(2-phenylbenzoyl)amino]benzoyl]amino]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[methyl-[4-[(2-phenylbenzoyl)amino]benzoyl]amino]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 22010932 |
| Molecular Formula | C33H32N2O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 6-[2-[methyl-[4-[(2-phenylbenzoyl)amino]benzoyl]amino]phenoxy]hexanoic acid |
| SMILES | CN(C(=O)c1ccc(NC(=O)c2ccccc2-c2ccccc2)cc1)c1ccccc1OCCCCCC(=O)O |
| InChI | InChI=1S/C33H32N2O5/c1-35(29-16-9-10-17-30(29)40-23-11-3-6-18-31(36)37)33(39)25-19-21-26(22-20-25)34-32(38)28-15-8-7-14-27(28)24-12-4-2-5-13-24/h2,4-5,7-10,12-17,19-22H,3,6,11,18,23H2,1H3,(H,34,38)(H,36,37) |
| InChIKey | ITQZWBNZIIKXOJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|