C34H40N4O7 — CID 18791474
2-[2-[[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]acetic acid (PubChem CID 18791474) has the molecular formula C34H40N4O7 and a molecular weight of 616.72 g/mol. Its IUPAC name is 2-[2-[[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 18791474 |
| Molecular Formula | C34H40N4O7 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 2-[2-[[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]acetic acid |
| SMILES | CN1CCN(C(=O)CCCCCOc2ccccc2N(C)C(=O)c2ccc(NC(=O)c3ccccc3OCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C34H40N4O7/c1-36-19-21-38(22-20-36)31(39)14-4-3-9-23-44-30-13-8-6-11-28(30)37(2)34(43)25-15-17-26(18-16-25)35-33(42)27-10-5-7-12-29(27)45-24-32(40)41/h5-8,10-13,15-18H,3-4,9,14,19-24H2,1-2H3,(H,35,42)(H,40,41) |
| InChIKey | XZNGPZXRRGJGOS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|