C33H41N5O4 — CID 22010823
4-methyl-N-[3-[2-[methyl-[4-[(2-propan-2-ylbenzoyl)amino]benzoyl]amino]phenoxy]propyl]piperazine-1-carboxamide (PubChem CID 22010823) has the molecular formula C33H41N5O4 and a molecular weight of 571.72 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-[methyl-[4-[(2-propan-2-ylbenzoyl)amino]benzoyl]amino]phenoxy]propyl]piperazine-1-carboxamide.
| Compound Name | 4-methyl-N-[3-[2-[methyl-[4-[(2-propan-2-ylbenzoyl)amino]benzoyl]amino]phenoxy]propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22010823 |
| Molecular Formula | C33H41N5O4 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 4-methyl-N-[3-[2-[methyl-[4-[(2-propan-2-ylbenzoyl)amino]benzoyl]amino]phenoxy]propyl]piperazine-1-carboxamide |
| SMILES | CC(C)c1ccccc1C(=O)Nc1ccc(C(=O)N(C)c2ccccc2OCCCNC(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C33H41N5O4/c1-24(2)27-10-5-6-11-28(27)31(39)35-26-16-14-25(15-17-26)32(40)37(4)29-12-7-8-13-30(29)42-23-9-18-34-33(41)38-21-19-36(3)20-22-38/h5-8,10-17,24H,9,18-23H2,1-4H3,(H,34,41)(H,35,39) |
| InChIKey | JCRMYPCPHASQNL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|