C43H46ClN5O7 — CID 54049840
2-chloro-4-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide (PubChem CID 54049840) has the molecular formula C43H46ClN5O7 and a molecular weight of 780.32 g/mol. Its IUPAC name is 2-chloro-4-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide.
| Compound Name | 2-chloro-4-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 54049840 |
| Molecular Formula | C43H46ClN5O7 |
| Molecular Weight | 780.32 g/mol |
| Exact Mass | 779.31 |
| IUPAC Name | 2-chloro-4-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
| SMILES | CN1CCN(C(=O)CCCCCOc2ccccc2N(C)C(=O)c2ccc(NC(=O)c3ccccc3OCCCN3C(=O)c4ccccc4C3=O)cc2Cl)CC1 |
| InChI | InChI=1S/C43H46ClN5O7/c1-46-23-25-48(26-24-46)39(50)19-4-3-11-27-56-38-18-10-8-16-36(38)47(2)41(52)33-21-20-30(29-35(33)44)45-40(51)34-15-7-9-17-37(34)55-28-12-22-49-42(53)31-13-5-6-14-32(31)43(49)54/h5-10,13-18,20-21,29H,3-4,11-12,19,22-28H2,1-2H3,(H,45,51) |
| InChIKey | LSCQTZDELKUHGL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.32 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|