C43H47N5O7 — CID 18791317
2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide (PubChem CID 18791317) has the molecular formula C43H47N5O7 and a molecular weight of 745.88 g/mol. Its IUPAC name is 2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide.
| Compound Name | 2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 18791317 |
| Molecular Formula | C43H47N5O7 |
| Molecular Weight | 745.88 g/mol |
| Exact Mass | 745.35 |
| IUPAC Name | 2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzoyl]amino]-N-methyl-N-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
| SMILES | CN1CCN(C(=O)CCCCCOc2ccccc2N(C)C(=O)c2ccccc2NC(=O)c2ccc(OCCCN3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C43H47N5O7/c1-45-25-27-47(28-26-45)39(49)19-4-3-11-29-55-38-18-10-9-17-37(38)46(2)41(51)35-15-7-8-16-36(35)44-40(50)31-20-22-32(23-21-31)54-30-12-24-48-42(52)33-13-5-6-14-34(33)43(48)53/h5-10,13-18,20-23H,3-4,11-12,19,24-30H2,1-2H3,(H,44,50) |
| InChIKey | KVFBUEASAFGRBI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|