C38H44N4O3 — CID 22011000
N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]carbamoyl]phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 22011000) has the molecular formula C38H44N4O3 and a molecular weight of 604.80 g/mol. Its IUPAC name is N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]carbamoyl]phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]carbamoyl]phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 22011000 |
| Molecular Formula | C38H44N4O3 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]carbamoyl]phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)N(C)c3ccccc3OCCCCCN3CCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C38H44N4O3/c1-29-15-17-30(18-16-29)33-11-5-6-12-34(33)37(43)39-32-21-19-31(20-22-32)38(44)41(3)35-13-7-8-14-36(35)45-28-10-4-9-23-42-26-24-40(2)25-27-42/h5-8,11-22H,4,9-10,23-28H2,1-3H3,(H,39,43) |
| InChIKey | QYTZNXLNWGGDON-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|