C36H45N5O4 — CID 57086198
2-(4-aminobutyl)-N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)-6-oxohex-5-enoxy]phenyl]carbamoyl]phenyl]benzamide (PubChem CID 57086198) has the molecular formula C36H45N5O4 and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-(4-aminobutyl)-N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)-6-oxohex-5-enoxy]phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-(4-aminobutyl)-N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)-6-oxohex-5-enoxy]phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 57086198 |
| Molecular Formula | C36H45N5O4 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 2-(4-aminobutyl)-N-[4-[methyl-[2-[5-(4-methylpiperazin-1-yl)-6-oxohex-5-enoxy]phenyl]carbamoyl]phenyl]benzamide |
| SMILES | CN1CCN(C(=C=O)CCCCOc2ccccc2N(C)C(=O)c2ccc(NC(=O)c3ccccc3CCCCN)cc2)CC1 |
| InChI | InChI=1S/C36H45N5O4/c1-39-22-24-41(25-23-39)31(27-42)13-8-10-26-45-34-16-6-5-15-33(34)40(2)36(44)29-17-19-30(20-18-29)38-35(43)32-14-4-3-11-28(32)12-7-9-21-37/h3-6,11,14-20H,7-10,12-13,21-26,37H2,1-2H3,(H,38,43) |
| InChIKey | CDYSIBRXMXKUSN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|