C44H49N5O7 — CID 18791525
2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-N-[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]benzamide (PubChem CID 18791525) has the molecular formula C44H49N5O7 and a molecular weight of 759.90 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-N-[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-N-[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18791525 |
| Molecular Formula | C44H49N5O7 |
| Molecular Weight | 759.90 g/mol |
| Exact Mass | 759.36 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-N-[4-[methyl-[2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]benzamide |
| SMILES | CN1CCN(C(=O)CCCCCOc2ccccc2N(C)C(=O)c2ccc(NC(=O)c3ccccc3OCCCCN3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C44H49N5O7/c1-46-26-28-48(29-27-46)40(50)20-4-3-12-30-56-39-19-10-8-17-37(39)47(2)42(52)32-21-23-33(24-22-32)45-41(51)36-16-7-9-18-38(36)55-31-13-11-25-49-43(53)34-14-5-6-15-35(34)44(49)54/h5-10,14-19,21-24H,3-4,11-13,20,25-31H2,1-2H3,(H,45,51) |
| InChIKey | MUYDHIBUKPRFTM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.90 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|