C34H34N2O4S — CID 22010752
6-[2-[methyl-[4-[[2-(4-methylphenyl)benzoyl]amino]benzoyl]amino]phenyl]sulfanylhexanoic acid (PubChem CID 22010752) has the molecular formula C34H34N2O4S and a molecular weight of 566.72 g/mol. Its IUPAC name is 6-[2-[methyl-[4-[[2-(4-methylphenyl)benzoyl]amino]benzoyl]amino]phenyl]sulfanylhexanoic acid.
| Compound Name | 6-[2-[methyl-[4-[[2-(4-methylphenyl)benzoyl]amino]benzoyl]amino]phenyl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 22010752 |
| Molecular Formula | C34H34N2O4S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 6-[2-[methyl-[4-[[2-(4-methylphenyl)benzoyl]amino]benzoyl]amino]phenyl]sulfanylhexanoic acid |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)N(C)c3ccccc3SCCCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H34N2O4S/c1-24-15-17-25(18-16-24)28-10-5-6-11-29(28)33(39)35-27-21-19-26(20-22-27)34(40)36(2)30-12-7-8-13-31(30)41-23-9-3-4-14-32(37)38/h5-8,10-13,15-22H,3-4,9,14,23H2,1-2H3,(H,35,39)(H,37,38) |
| InChIKey | KHTQSQOFNJMUBL-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|