C20H30O4S2 — CID 18795791
10-[2-(3-carboxypropylsulfanyl)phenyl]sulfanyldecanoic acid (PubChem CID 18795791) has the molecular formula C20H30O4S2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 10-[2-(3-carboxypropylsulfanyl)phenyl]sulfanyldecanoic acid.
| Compound Name | 10-[2-(3-carboxypropylsulfanyl)phenyl]sulfanyldecanoic acid |
|---|---|
| PubChem CID | 18795791 |
| Molecular Formula | C20H30O4S2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 10-[2-(3-carboxypropylsulfanyl)phenyl]sulfanyldecanoic acid |
| SMILES | O=C(O)CCCCCCCCCSc1ccccc1SCCCC(=O)O |
| InChI | InChI=1S/C20H30O4S2/c21-19(22)13-6-4-2-1-3-5-9-15-25-17-11-7-8-12-18(17)26-16-10-14-20(23)24/h7-8,11-12H,1-6,9-10,13-16H2,(H,21,22)(H,23,24) |
| InChIKey | JTLRUMXONCRHAY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|