C19H29NO6S2 — CID 18795877
9-oxo-9-[2-(4-sulfobutylsulfanyl)anilino]nonanoic acid (PubChem CID 18795877) has the molecular formula C19H29NO6S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 9-oxo-9-[2-(4-sulfobutylsulfanyl)anilino]nonanoic acid.
| Compound Name | 9-oxo-9-[2-(4-sulfobutylsulfanyl)anilino]nonanoic acid |
|---|---|
| PubChem CID | 18795877 |
| Molecular Formula | C19H29NO6S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 9-oxo-9-[2-(4-sulfobutylsulfanyl)anilino]nonanoic acid |
| SMILES | O=C(O)CCCCCCCC(=O)Nc1ccccc1SCCCCS(=O)(=O)O |
| InChI | InChI=1S/C19H29NO6S2/c21-18(12-4-2-1-3-5-13-19(22)23)20-16-10-6-7-11-17(16)27-14-8-9-15-28(24,25)26/h6-7,10-11H,1-5,8-9,12-15H2,(H,20,21)(H,22,23)(H,24,25,26) |
| InChIKey | VRTZVQYXBHMGLI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|