C19H20Cl2N2O2S2 — CID 16679797
2-chloro-N-[2-[3-[2-[(2-chloroacetyl)amino]phenyl]sulfanylpropylsulfanyl]phenyl]acetamide (PubChem CID 16679797) has the molecular formula C19H20Cl2N2O2S2 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-[2-[(2-chloroacetyl)amino]phenyl]sulfanylpropylsulfanyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[2-[3-[2-[(2-chloroacetyl)amino]phenyl]sulfanylpropylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 16679797 |
| Molecular Formula | C19H20Cl2N2O2S2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 2-chloro-N-[2-[3-[2-[(2-chloroacetyl)amino]phenyl]sulfanylpropylsulfanyl]phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccccc1SCCCSc1ccccc1NC(=O)CCl |
| InChI | InChI=1S/C19H20Cl2N2O2S2/c20-12-18(24)22-14-6-1-3-8-16(14)26-10-5-11-27-17-9-4-2-7-15(17)23-19(25)13-21/h1-4,6-9H,5,10-13H2,(H,22,24)(H,23,25) |
| InChIKey | TZOJOERKPDPRCN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|