C10H9ClF3NOS — CID 43167988
2-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]acetamide (PubChem CID 43167988) has the molecular formula C10H9ClF3NOS and a molecular weight of 283.70 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43167988 |
| Molecular Formula | C10H9ClF3NOS |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NOS/c11-5-9(16)15-7-3-1-2-4-8(7)17-6-10(12,13)14/h1-4H,5-6H2,(H,15,16) |
| InChIKey | JNGNLAUXYNTYNY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|