C15H20F3N3O2S — CID 47033314
2-methyl-N-[2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]carbamoylamino]ethyl]propanamide (PubChem CID 47033314) has the molecular formula C15H20F3N3O2S and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-methyl-N-[2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]carbamoylamino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]carbamoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 47033314 |
| Molecular Formula | C15H20F3N3O2S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-methyl-N-[2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]carbamoylamino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O2S/c1-10(2)13(22)19-7-8-20-14(23)21-11-5-3-4-6-12(11)24-9-15(16,17)18/h3-6,10H,7-9H2,1-2H3,(H,19,22)(H2,20,21,23) |
| InChIKey | QXKSITRBJUCJET-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|