C12H12F3NO3S — CID 43579901
4-oxo-4-[2-(2,2,2-trifluoroethylsulfanyl)anilino]butanoic acid (PubChem CID 43579901) has the molecular formula C12H12F3NO3S and a molecular weight of 307.29 g/mol. Its IUPAC name is 4-oxo-4-[2-(2,2,2-trifluoroethylsulfanyl)anilino]butanoic acid.
| Compound Name | 4-oxo-4-[2-(2,2,2-trifluoroethylsulfanyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 43579901 |
| Molecular Formula | C12H12F3NO3S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-oxo-4-[2-(2,2,2-trifluoroethylsulfanyl)anilino]butanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C12H12F3NO3S/c13-12(14,15)7-20-9-4-2-1-3-8(9)16-10(17)5-6-11(18)19/h1-4H,5-7H2,(H,16,17)(H,18,19) |
| InChIKey | RHFCYDLMWUYJTP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |