C10H10F3NO4S2 — CID 43361756
2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]sulfamoyl]acetic acid (PubChem CID 43361756) has the molecular formula C10H10F3NO4S2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]sulfamoyl]acetic acid.
| Compound Name | 2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43361756 |
| Molecular Formula | C10H10F3NO4S2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]sulfamoyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO4S2/c11-10(12,13)6-19-8-4-2-1-3-7(8)14-20(17,18)5-9(15)16/h1-4,14H,5-6H2,(H,15,16) |
| InChIKey | PDYHSARNVNLRBJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |