C8H9F3N2O2S2 — CID 112573492
1-(sulfamoylamino)-2-(2,2,2-trifluoroethylsulfanyl)benzene (PubChem CID 112573492) has the molecular formula C8H9F3N2O2S2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-(sulfamoylamino)-2-(2,2,2-trifluoroethylsulfanyl)benzene.
| Compound Name | 1-(sulfamoylamino)-2-(2,2,2-trifluoroethylsulfanyl)benzene |
|---|---|
| PubChem CID | 112573492 |
| Molecular Formula | C8H9F3N2O2S2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1-(sulfamoylamino)-2-(2,2,2-trifluoroethylsulfanyl)benzene |
| SMILES | NS(=O)(=O)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O2S2/c9-8(10,11)5-16-7-4-2-1-3-6(7)13-17(12,14)15/h1-4,13H,5H2,(H2,12,14,15) |
| InChIKey | VYTCMCTYMHIYHG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |