C11H10F3N3O2S2 — CID 102691731
N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102691731) has the molecular formula C11H10F3N3O2S2 and a molecular weight of 337.35 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691731 |
| Molecular Formula | C11H10F3N3O2S2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1SCC(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C11H10F3N3O2S2/c12-11(13,14)7-20-9-4-2-1-3-8(9)17-21(18,19)10-5-6-15-16-10/h1-6,17H,7H2,(H,15,16) |
| InChIKey | ARZFGCWKPPCLRM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |