C13H16N4O2S — CID 102692559
N-(2-pyrrolidin-1-ylphenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692559) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylphenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-pyrrolidin-1-ylphenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692559 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(2-pyrrolidin-1-ylphenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1N1CCCC1)c1ccn[nH]1 |
| InChI | InChI=1S/C13H16N4O2S/c18-20(19,13-7-8-14-15-13)16-11-5-1-2-6-12(11)17-9-3-4-10-17/h1-2,5-8,16H,3-4,9-10H2,(H,14,15) |
| InChIKey | WKWGNKYOVSFFIK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |