C17H19BrN2O2S — CID 2435475
4-bromo-N-(2-piperidin-1-ylphenyl)benzenesulfonamide (PubChem CID 2435475) has the molecular formula C17H19BrN2O2S and a molecular weight of 395.32 g/mol. Its IUPAC name is 4-bromo-N-(2-piperidin-1-ylphenyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(2-piperidin-1-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2435475 |
| Molecular Formula | C17H19BrN2O2S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 4-bromo-N-(2-piperidin-1-ylphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1N1CCCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrN2O2S/c18-14-8-10-15(11-9-14)23(21,22)19-16-6-2-3-7-17(16)20-12-4-1-5-13-20/h2-3,6-11,19H,1,4-5,12-13H2 |
| InChIKey | PTHFVGMUNSLKLH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |