C11H13N3O2S — CID 102691585
N-(2-ethylphenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691585) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-ethylphenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691585 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(2-ethylphenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCc1ccccc1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H13N3O2S/c1-2-9-5-3-4-6-10(9)14-17(15,16)11-7-8-12-13-11/h3-8,14H,2H2,1H3,(H,12,13) |
| InChIKey | LZEPZHTYWMIBMC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |