C16H14F3NO3S2 — CID 43043214
2-methylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide (PubChem CID 43043214) has the molecular formula C16H14F3NO3S2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide.
| Compound Name | 2-methylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43043214 |
| Molecular Formula | C16H14F3NO3S2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-methylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C16H14F3NO3S2/c1-25(22,23)14-9-5-2-6-11(14)15(21)20-12-7-3-4-8-13(12)24-10-16(17,18)19/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | NBCTXDBOKZWNHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |