C16H15F3N2OS — CID 99841149
2-methylsulfanyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzamide (PubChem CID 99841149) has the molecular formula C16H15F3N2OS and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzamide.
| Compound Name | 2-methylsulfanyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 99841149 |
| Molecular Formula | C16H15F3N2OS |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-methylsulfanyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzamide |
| SMILES | CSc1ccccc1C(=O)Nc1ccccc1NCC(F)(F)F |
| InChI | InChI=1S/C16H15F3N2OS/c1-23-14-9-5-2-6-11(14)15(22)21-13-8-4-3-7-12(13)20-10-16(17,18)19/h2-9,20H,10H2,1H3,(H,21,22) |
| InChIKey | YUNMYKRELZQZMN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |