C15H11ClF3NOS — CID 16623224
4-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide (PubChem CID 16623224) has the molecular formula C15H11ClF3NOS and a molecular weight of 345.77 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 16623224 |
| Molecular Formula | C15H11ClF3NOS |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-chloro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClF3NOS/c16-11-7-5-10(6-8-11)14(21)20-12-3-1-2-4-13(12)22-9-15(17,18)19/h1-8H,9H2,(H,20,21) |
| InChIKey | BRSHFHBEEDPEEV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |