C15H10F5NOS — CID 43041819
2,5-difluoro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide (PubChem CID 43041819) has the molecular formula C15H10F5NOS and a molecular weight of 347.31 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide.
| Compound Name | 2,5-difluoro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43041819 |
| Molecular Formula | C15H10F5NOS |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2,5-difluoro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCC(F)(F)F)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H10F5NOS/c16-9-5-6-11(17)10(7-9)14(22)21-12-3-1-2-4-13(12)23-8-15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | XGVVGLLAJCUDRO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |