C17H13F4NOS — CID 16623249
(E)-3-(3-fluorophenyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 16623249) has the molecular formula C17H13F4NOS and a molecular weight of 355.36 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16623249 |
| Molecular Formula | C17H13F4NOS |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)Nc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C17H13F4NOS/c18-13-5-3-4-12(10-13)8-9-16(23)22-14-6-1-2-7-15(14)24-11-17(19,20)21/h1-10H,11H2,(H,22,23)/b9-8+ |
| InChIKey | GYPGNVANRLSHHN-CMDGGOBGSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|