C21H24FNO — CID 8779107
(E)-N-[2,6-di(propan-2-yl)phenyl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 8779107) has the molecular formula C21H24FNO and a molecular weight of 325.43 g/mol. Its IUPAC name is (E)-N-[2,6-di(propan-2-yl)phenyl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2,6-di(propan-2-yl)phenyl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8779107 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (E)-N-[2,6-di(propan-2-yl)phenyl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C21H24FNO/c1-14(2)18-9-6-10-19(15(3)4)21(18)23-20(24)12-11-16-7-5-8-17(22)13-16/h5-15H,1-4H3,(H,23,24)/b12-11+ |
| InChIKey | VDFQJVJSMUFTHF-VAWYXSNFSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|