C17H14F3NO — CID 8782179
(E)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 8782179) has the molecular formula C17H14F3NO and a molecular weight of 305.30 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8782179 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (E)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C=C/c1cccc(F)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F3NO/c1-11(15-7-6-14(19)10-16(15)20)21-17(22)8-5-12-3-2-4-13(18)9-12/h2-11H,1H3,(H,21,22)/b8-5+/t11-/m1/s1 |
| InChIKey | DVBOCZYAPIROKQ-AYLMVEPYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|