C19H20F2N2O — CID 42907058
(E)-N-[1-(2,4-difluorophenyl)ethyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 42907058) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is (E)-N-[1-(2,4-difluorophenyl)ethyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(2,4-difluorophenyl)ethyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 42907058 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (E)-N-[1-(2,4-difluorophenyl)ethyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(N(C)C)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H20F2N2O/c1-13(17-10-7-15(20)12-18(17)21)22-19(24)11-6-14-4-8-16(9-5-14)23(2)3/h4-13H,1-3H3,(H,22,24)/b11-6+ |
| InChIKey | NDQQYKNDWAYWCS-IZZDOVSWSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|