C15H10ClF3N2O3S — CID 43043195
2-chloro-5-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide (PubChem CID 43043195) has the molecular formula C15H10ClF3N2O3S and a molecular weight of 390.77 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43043195 |
| Molecular Formula | C15H10ClF3N2O3S |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-chloro-5-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCC(F)(F)F)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H10ClF3N2O3S/c16-11-6-5-9(21(23)24)7-10(11)14(22)20-12-3-1-2-4-13(12)25-8-15(17,18)19/h1-7H,8H2,(H,20,22) |
| InChIKey | GSNREFGUAZUVGA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|