C18H17F3N2O3S2 — CID 55554211
4-(prop-2-enylsulfamoyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide (PubChem CID 55554211) has the molecular formula C18H17F3N2O3S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-(prop-2-enylsulfamoyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide.
| Compound Name | 4-(prop-2-enylsulfamoyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55554211 |
| Molecular Formula | C18H17F3N2O3S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 4-(prop-2-enylsulfamoyl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)Nc2ccccc2SCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O3S2/c1-2-11-22-28(25,26)14-9-7-13(8-10-14)17(24)23-15-5-3-4-6-16(15)27-12-18(19,20)21/h2-10,22H,1,11-12H2,(H,23,24) |
| InChIKey | JASQCSSSVBWJBJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|