C13H11F3N4O3S2 — CID 38783251
4-(prop-2-enylsulfamoyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 38783251) has the molecular formula C13H11F3N4O3S2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 4-(prop-2-enylsulfamoyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-(prop-2-enylsulfamoyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 38783251 |
| Molecular Formula | C13H11F3N4O3S2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 4-(prop-2-enylsulfamoyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)Nc2nnc(C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C13H11F3N4O3S2/c1-2-7-17-25(22,23)9-5-3-8(4-6-9)10(21)18-12-20-19-11(24-12)13(14,15)16/h2-6,17H,1,7H2,(H,18,20,21) |
| InChIKey | KHVLBPCILHBJKG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|