C17H20F2N4OS — CID 177325548
CID 177325548 (PubChem CID 177325548) has the molecular formula C17H20F2N4OS and a molecular weight of 366.44 g/mol.
| Compound Name | CID 177325548 |
|---|---|
| PubChem CID | 177325548 |
| Molecular Formula | C17H20F2N4OS |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | — |
| SMILES | [CH2]CCN(CC[CH2])c1ccc(C(=O)Nc2nnc(C(C)(F)F)s2)cc1 |
| InChI | InChI=1S/C17H20F2N4OS/c1-4-10-23(11-5-2)13-8-6-12(7-9-13)14(24)20-16-22-21-15(25-16)17(3,18)19/h6-9H,1-2,4-5,10-11H2,3H3,(H,20,22,24) |
| InChIKey | JAOVDQVKCHAAOL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |