C14H16N4O2S — CID 55978390
4-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzene-1,4-dicarboxamide (PubChem CID 55978390) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55978390 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzene-1,4-dicarboxamide |
| SMILES | CC(C)(C)c1nnc(NC(=O)c2ccc(C(N)=O)cc2)s1 |
| InChI | InChI=1S/C14H16N4O2S/c1-14(2,3)12-17-18-13(21-12)16-11(20)9-6-4-8(5-7-9)10(15)19/h4-7H,1-3H3,(H2,15,19)(H,16,18,20) |
| InChIKey | ONKLAHTVQNVWNK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |